C24H26F2N2O2 — CID 154856805
(E)-N-[1-[3-(3,4-difluorophenyl)butanoyl]piperidin-4-yl]-3-phenylprop-2-enamide (PubChem CID 154856805) has the molecular formula C24H26F2N2O2 and a molecular weight of 412.48 g/mol. Its IUPAC name is (E)-N-[1-[3-(3,4-difluorophenyl)butanoyl]piperidin-4-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-[3-(3,4-difluorophenyl)butanoyl]piperidin-4-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 154856805 |
| Molecular Formula | C24H26F2N2O2 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (E)-N-[1-[3-(3,4-difluorophenyl)butanoyl]piperidin-4-yl]-3-phenylprop-2-enamide |
| SMILES | CC(CC(=O)N1CCC(NC(=O)/C=C/c2ccccc2)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H26F2N2O2/c1-17(19-8-9-21(25)22(26)16-19)15-24(30)28-13-11-20(12-14-28)27-23(29)10-7-18-5-3-2-4-6-18/h2-10,16-17,20H,11-15H2,1H3,(H,27,29)/b10-7+ |
| InChIKey | GQPHWVUCECAQAJ-JXMROGBWSA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|