C21H22BrFN2O2 — CID 18289148
(E)-3-(5-bromo-2-fluorophenyl)-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 18289148) has the molecular formula C21H22BrFN2O2 and a molecular weight of 433.32 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 18289148 |
| Molecular Formula | C21H22BrFN2O2 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)NCc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H22BrFN2O2/c22-19-6-7-20(23)18(13-19)5-8-21(26)24-14-16-1-3-17(4-2-16)15-25-9-11-27-12-10-25/h1-8,13H,9-12,14-15H2,(H,24,26)/b8-5+ |
| InChIKey | BKHRZNWZFOTORA-VMPITWQZSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|