C22H24F2N2O3 — CID 58633339
(E)-3-(2,5-difluorophenyl)-N-[(1S)-2-hydroxy-1-[3-(morpholin-4-ylmethyl)phenyl]ethyl]prop-2-enamide (PubChem CID 58633339) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[(1S)-2-hydroxy-1-[3-(morpholin-4-ylmethyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[(1S)-2-hydroxy-1-[3-(morpholin-4-ylmethyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 58633339 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[(1S)-2-hydroxy-1-[3-(morpholin-4-ylmethyl)phenyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)ccc1F)N[C@H](CO)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C22H24F2N2O3/c23-19-5-6-20(24)17(13-19)4-7-22(28)25-21(15-27)18-3-1-2-16(12-18)14-26-8-10-29-11-9-26/h1-7,12-13,21,27H,8-11,14-15H2,(H,25,28)/b7-4+/t21-/m1/s1 |
| InChIKey | RNKRQHLEWYSBHH-HXRGIAOBSA-N |
| XLogP | 2.66 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|