C21H22ClFN2O3 — CID 90887955
3-(4-chloro-2-fluorophenyl)-N-[(1S)-2-hydroxy-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide (PubChem CID 90887955) has the molecular formula C21H22ClFN2O3 and a molecular weight of 404.87 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorophenyl)-N-[(1S)-2-hydroxy-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide.
| Compound Name | 3-(4-chloro-2-fluorophenyl)-N-[(1S)-2-hydroxy-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 90887955 |
| Molecular Formula | C21H22ClFN2O3 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3-(4-chloro-2-fluorophenyl)-N-[(1S)-2-hydroxy-1-(3-morpholin-4-ylphenyl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1F)N[C@H](CO)c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C21H22ClFN2O3/c22-17-6-4-15(19(23)13-17)5-7-21(27)24-20(14-26)16-2-1-3-18(12-16)25-8-10-28-11-9-25/h1-7,12-13,20,26H,8-11,14H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | KARYBYPDJPLDKF-HXUWFJFHSA-N |
| XLogP | 3.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|