C21H21F3N2O3 — CID 58633303
(E)-3-(3,5-difluorophenyl)-N-[(1R)-1-(4-fluoro-3-morpholin-4-ylphenyl)-2-hydroxyethyl]prop-2-enamide (PubChem CID 58633303) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-N-[(1R)-1-(4-fluoro-3-morpholin-4-ylphenyl)-2-hydroxyethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-difluorophenyl)-N-[(1R)-1-(4-fluoro-3-morpholin-4-ylphenyl)-2-hydroxyethyl]prop-2-enamide |
|---|---|
| PubChem CID | 58633303 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-N-[(1R)-1-(4-fluoro-3-morpholin-4-ylphenyl)-2-hydroxyethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)cc(F)c1)N[C@@H](CO)c1ccc(F)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C21H21F3N2O3/c22-16-9-14(10-17(23)12-16)1-4-21(28)25-19(13-27)15-2-3-18(24)20(11-15)26-5-7-29-8-6-26/h1-4,9-12,19,27H,5-8,13H2,(H,25,28)/b4-1+/t19-/m0/s1 |
| InChIKey | GQXPEWRAQGPOCF-KIYPBCMGSA-N |
| XLogP | 2.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|