C23H26F2N2O2 — CID 142190356
(E)-3-(5-ethyl-2-fluorophenyl)-N-[1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]prop-2-enamide (PubChem CID 142190356) has the molecular formula C23H26F2N2O2 and a molecular weight of 400.47 g/mol. Its IUPAC name is (E)-3-(5-ethyl-2-fluorophenyl)-N-[1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-ethyl-2-fluorophenyl)-N-[1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 142190356 |
| Molecular Formula | C23H26F2N2O2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (E)-3-(5-ethyl-2-fluorophenyl)-N-[1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]prop-2-enamide |
| SMILES | CCc1ccc(F)c(/C=C/C(=O)NC(C)c2ccc(F)c(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C23H26F2N2O2/c1-3-17-4-7-20(24)19(14-17)6-9-23(28)26-16(2)18-5-8-21(25)22(15-18)27-10-12-29-13-11-27/h4-9,14-16H,3,10-13H2,1-2H3,(H,26,28)/b9-6+ |
| InChIKey | ZXXJCWWQAOGNBW-RMKNXTFCSA-N |
| XLogP | 4.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|