C21H23FN2O2 — CID 11473692
(E)-N-[(1S)-1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]-3-phenylprop-2-enamide (PubChem CID 11473692) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is (E)-N-[(1S)-1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11473692 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (E)-N-[(1S)-1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl]-3-phenylprop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccccc1)c1ccc(F)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C21H23FN2O2/c1-16(23-21(25)10-7-17-5-3-2-4-6-17)18-8-9-19(22)20(15-18)24-11-13-26-14-12-24/h2-10,15-16H,11-14H2,1H3,(H,23,25)/b10-7+/t16-/m0/s1 |
| InChIKey | CGYAPKNMCALELZ-JCVNQNCUSA-N |
| XLogP | 3.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|