C34H44N4O3 — CID 161134519
1-(3-morpholin-4-ylphenyl)ethanamine;(E)-N-[1-(3-morpholin-4-ylphenyl)propyl]-3-phenylprop-2-enamide (PubChem CID 161134519) has the molecular formula C34H44N4O3 and a molecular weight of 556.75 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylphenyl)ethanamine;(E)-N-[1-(3-morpholin-4-ylphenyl)propyl]-3-phenylprop-2-enamide.
| Compound Name | 1-(3-morpholin-4-ylphenyl)ethanamine;(E)-N-[1-(3-morpholin-4-ylphenyl)propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 161134519 |
| Molecular Formula | C34H44N4O3 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | 1-(3-morpholin-4-ylphenyl)ethanamine;(E)-N-[1-(3-morpholin-4-ylphenyl)propyl]-3-phenylprop-2-enamide |
| SMILES | CC(N)c1cccc(N2CCOCC2)c1.CCC(NC(=O)/C=C/c1ccccc1)c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C22H26N2O2.C12H18N2O/c1-2-21(23-22(25)12-11-18-7-4-3-5-8-18)19-9-6-10-20(17-19)24-13-15-26-16-14-24;1-10(13)11-3-2-4-12(9-11)14-5-7-15-8-6-14/h3-12,17,21H,2,13-16H2,1H3,(H,23,25);2-4,9-10H,5-8,13H2,1H3/b12-11+; |
| InChIKey | UMPTWKRCOYDFMC-CALJPSDSSA-N |
| XLogP | 5.35 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|