C14H16FNO3 — CID 109375365
(E)-3-[5-fluoro-2-(morpholin-4-ylmethyl)phenyl]prop-2-enoic acid (PubChem CID 109375365) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is (E)-3-[5-fluoro-2-(morpholin-4-ylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-fluoro-2-(morpholin-4-ylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375365 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (E)-3-[5-fluoro-2-(morpholin-4-ylmethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)ccc1CN1CCOCC1 |
| InChI | InChI=1S/C14H16FNO3/c15-13-3-1-12(10-16-5-7-19-8-6-16)11(9-13)2-4-14(17)18/h1-4,9H,5-8,10H2,(H,17,18)/b4-2+ |
| InChIKey | APNWYRZWILVZTM-DUXPYHPUSA-N |
| XLogP | 1.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|