C16H20FNO2 — CID 76909181
3-[2-(azepan-1-ylmethyl)-5-fluorophenyl]prop-2-enoic acid (PubChem CID 76909181) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-[2-(azepan-1-ylmethyl)-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[2-(azepan-1-ylmethyl)-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76909181 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-[2-(azepan-1-ylmethyl)-5-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(F)ccc1CN1CCCCCC1 |
| InChI | InChI=1S/C16H20FNO2/c17-15-7-5-14(13(11-15)6-8-16(19)20)12-18-9-3-1-2-4-10-18/h5-8,11H,1-4,9-10,12H2,(H,19,20) |
| InChIKey | ONHAFBYRNOOWKH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|