C27H38N2O9 — CID 86737178
bis((Z)-but-2-enedioic acid);1-[[4-methoxy-2-(piperidin-1-ylmethyl)phenyl]methyl]piperidine (PubChem CID 86737178) has the molecular formula C27H38N2O9 and a molecular weight of 534.61 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);1-[[4-methoxy-2-(piperidin-1-ylmethyl)phenyl]methyl]piperidine.
| Compound Name | bis((Z)-but-2-enedioic acid);1-[[4-methoxy-2-(piperidin-1-ylmethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 86737178 |
| Molecular Formula | C27H38N2O9 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);1-[[4-methoxy-2-(piperidin-1-ylmethyl)phenyl]methyl]piperidine |
| SMILES | COc1ccc(CN2CCCCC2)c(CN2CCCCC2)c1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H30N2O.2C4H4O4/c1-22-19-9-8-17(15-20-10-4-2-5-11-20)18(14-19)16-21-12-6-3-7-13-21;2*5-3(6)1-2-4(7)8/h8-9,14H,2-7,10-13,15-16H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | AWSJINLHSRQNAE-SPIKMXEPSA-N |
| XLogP | 3.09 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|