C14H22BNO3 — CID 65323323
[2-(azepan-1-ylmethyl)-4-methoxyphenyl]boronic acid (PubChem CID 65323323) has the molecular formula C14H22BNO3 and a molecular weight of 263.15 g/mol. Its IUPAC name is [2-(azepan-1-ylmethyl)-4-methoxyphenyl]boronic acid.
| Compound Name | [2-(azepan-1-ylmethyl)-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 65323323 |
| Molecular Formula | C14H22BNO3 |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | [2-(azepan-1-ylmethyl)-4-methoxyphenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(CN2CCCCCC2)c1 |
| InChI | InChI=1S/C14H22BNO3/c1-19-13-6-7-14(15(17)18)12(10-13)11-16-8-4-2-3-5-9-16/h6-7,10,17-18H,2-5,8-9,11H2,1H3 |
| InChIKey | FUNXOVFHOZPRHQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|