About [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid
[2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid (PubChem CID 104968437) has the molecular formula C15H24BNO3
and a molecular weight of 277.17 g/mol. Its IUPAC name is [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid.
Molecular Properties
| Compound Name | [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid |
| PubChem CID | 104968437 |
| Molecular Formula | C15H24BNO3 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(CN2[C@H](C)CCC[C@@H]2C)c1 |
| InChI | InChI=1S/C15H24BNO3/c1-11-5-4-6-12(2)17(11)10-13-9-14(20-3)7-8-15(13)16(18)19/h7-9,11-12,18-19H,4-6,10H2,1-3H3/t11-,12+ |
| InChIKey | GSEALLYIYDRSBY-TXEJJXNPSA-N |
| XLogP | 1.14 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid?
The IUPAC name of [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid (CID 104968437) is [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid.
What is the SMILES notation for [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid?
The canonical SMILES for [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid is COc1ccc(B(O)O)c(CN2[C@H](C)CCC[C@@H]2C)c1.
What is the InChIKey of [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid?
The InChIKey is GSEALLYIYDRSBY-TXEJJXNPSA-N. The full InChI is InChI=1S/C15H24BNO3/c1-11-5-4-6-12(2)17(11)10-13-9-14(20-3)7-8-15(13)16(18)19/h7-9,11-12,18-19H,4-6,10H2,1-3H3/t11-,12+.
What are the key properties of [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid?
[2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid has a molecular weight of 277.17 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-4-methoxyphenyl]boronic acid is sourced from PubChem (CID 104968437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).