C13H19BO4S — CID 107754343
[4-methoxy-2-[(2-methyloxolan-3-yl)sulfanylmethyl]phenyl]boronic acid (PubChem CID 107754343) has the molecular formula C13H19BO4S and a molecular weight of 282.17 g/mol. Its IUPAC name is [4-methoxy-2-[(2-methyloxolan-3-yl)sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [4-methoxy-2-[(2-methyloxolan-3-yl)sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 107754343 |
| Molecular Formula | C13H19BO4S |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [4-methoxy-2-[(2-methyloxolan-3-yl)sulfanylmethyl]phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(CSC2CCOC2C)c1 |
| InChI | InChI=1S/C13H19BO4S/c1-9-13(5-6-18-9)19-8-10-7-11(17-2)3-4-12(10)14(15)16/h3-4,7,9,13,15-16H,5-6,8H2,1-2H3 |
| InChIKey | QXKKXUHLTFBPJK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|