C13H19BO5 — CID 65327740
[4-methoxy-2-(oxolan-2-ylmethoxymethyl)phenyl]boronic acid (PubChem CID 65327740) has the molecular formula C13H19BO5 and a molecular weight of 266.10 g/mol. Its IUPAC name is [4-methoxy-2-(oxolan-2-ylmethoxymethyl)phenyl]boronic acid.
| Compound Name | [4-methoxy-2-(oxolan-2-ylmethoxymethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 65327740 |
| Molecular Formula | C13H19BO5 |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [4-methoxy-2-(oxolan-2-ylmethoxymethyl)phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(COCC2CCCO2)c1 |
| InChI | InChI=1S/C13H19BO5/c1-17-11-4-5-13(14(15)16)10(7-11)8-18-9-12-3-2-6-19-12/h4-5,7,12,15-16H,2-3,6,8-9H2,1H3 |
| InChIKey | MMNRXINVEFSZIQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|