C12H15BrO3 — CID 104705218
2-[(2-bromo-4-methoxyphenoxy)methyl]oxolane (PubChem CID 104705218) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is 2-[(2-bromo-4-methoxyphenoxy)methyl]oxolane.
| Compound Name | 2-[(2-bromo-4-methoxyphenoxy)methyl]oxolane |
|---|---|
| PubChem CID | 104705218 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-[(2-bromo-4-methoxyphenoxy)methyl]oxolane |
| SMILES | COc1ccc(OCC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C12H15BrO3/c1-14-9-4-5-12(11(13)7-9)16-8-10-3-2-6-15-10/h4-5,7,10H,2-3,6,8H2,1H3 |
| InChIKey | ZRVPYZBIDGLARZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |