C16H19ClO3 — CID 104706796
2-[[2-(3-chloroprop-1-ynyl)-4-methoxyphenoxy]methyl]oxane (PubChem CID 104706796) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-[[2-(3-chloroprop-1-ynyl)-4-methoxyphenoxy]methyl]oxane.
| Compound Name | 2-[[2-(3-chloroprop-1-ynyl)-4-methoxyphenoxy]methyl]oxane |
|---|---|
| PubChem CID | 104706796 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[[2-(3-chloroprop-1-ynyl)-4-methoxyphenoxy]methyl]oxane |
| SMILES | COc1ccc(OCC2CCCCO2)c(C#CCCl)c1 |
| InChI | InChI=1S/C16H19ClO3/c1-18-14-7-8-16(13(11-14)5-4-9-17)20-12-15-6-2-3-10-19-15/h7-8,11,15H,2-3,6,9-10,12H2,1H3 |
| InChIKey | FDIBFDJOFSPFSU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|