C12H16O2S — CID 97294081
2-[[(2S)-oxolan-2-yl]methoxymethyl]benzenethiol (PubChem CID 97294081) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-[[(2S)-oxolan-2-yl]methoxymethyl]benzenethiol.
| Compound Name | 2-[[(2S)-oxolan-2-yl]methoxymethyl]benzenethiol |
|---|---|
| PubChem CID | 97294081 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-[[(2S)-oxolan-2-yl]methoxymethyl]benzenethiol |
| SMILES | Sc1ccccc1COC[C@@H]1CCCO1 |
| InChI | InChI=1S/C12H16O2S/c15-12-6-2-1-4-10(12)8-13-9-11-5-3-7-14-11/h1-2,4,6,11,15H,3,5,7-9H2/t11-/m0/s1 |
| InChIKey | RLVDLPOZQVXEGG-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|