C12H14N2O2 — CID 62920439
3-(oxolan-2-ylmethoxymethyl)pyridine-2-carbonitrile (PubChem CID 62920439) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethoxymethyl)pyridine-2-carbonitrile.
| Compound Name | 3-(oxolan-2-ylmethoxymethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62920439 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(oxolan-2-ylmethoxymethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1COCC1CCCO1 |
| InChI | InChI=1S/C12H14N2O2/c13-7-12-10(3-1-5-14-12)8-15-9-11-4-2-6-16-11/h1,3,5,11H,2,4,6,8-9H2 |
| InChIKey | PCSJSGQXKBVCRG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |