C11H17NO3 — CID 62444972
[3-(oxolan-2-ylmethoxymethyl)furan-2-yl]methanamine (PubChem CID 62444972) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is [3-(oxolan-2-ylmethoxymethyl)furan-2-yl]methanamine.
| Compound Name | [3-(oxolan-2-ylmethoxymethyl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 62444972 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [3-(oxolan-2-ylmethoxymethyl)furan-2-yl]methanamine |
| SMILES | NCc1occc1COCC1CCCO1 |
| InChI | InChI=1S/C11H17NO3/c12-6-11-9(3-5-15-11)7-13-8-10-2-1-4-14-10/h3,5,10H,1-2,4,6-8,12H2 |
| InChIKey | BJJCXAQFRUIJMI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |