C13H21NO3 — CID 62445276
[5-methyl-4-(oxan-2-ylmethoxymethyl)furan-2-yl]methanamine (PubChem CID 62445276) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is [5-methyl-4-(oxan-2-ylmethoxymethyl)furan-2-yl]methanamine.
| Compound Name | [5-methyl-4-(oxan-2-ylmethoxymethyl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 62445276 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [5-methyl-4-(oxan-2-ylmethoxymethyl)furan-2-yl]methanamine |
| SMILES | Cc1oc(CN)cc1COCC1CCCCO1 |
| InChI | InChI=1S/C13H21NO3/c1-10-11(6-13(7-14)17-10)8-15-9-12-4-2-3-5-16-12/h6,12H,2-5,7-9,14H2,1H3 |
| InChIKey | QHNLDGQNEFVLSR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |