C10H15NO2 — CID 62442483
[5-methyl-4-(prop-2-enoxymethyl)furan-2-yl]methanamine (PubChem CID 62442483) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is [5-methyl-4-(prop-2-enoxymethyl)furan-2-yl]methanamine.
| Compound Name | [5-methyl-4-(prop-2-enoxymethyl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 62442483 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | [5-methyl-4-(prop-2-enoxymethyl)furan-2-yl]methanamine |
| SMILES | C=CCOCc1cc(CN)oc1C |
| InChI | InChI=1S/C10H15NO2/c1-3-4-12-7-9-5-10(6-11)13-8(9)2/h3,5H,1,4,6-7,11H2,2H3 |
| InChIKey | OLVGKEMEHXPAAO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|