C13H12BrCl2NO2 — CID 107661009
[4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methanamine (PubChem CID 107661009) has the molecular formula C13H12BrCl2NO2 and a molecular weight of 365.05 g/mol. Its IUPAC name is [4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methanamine.
| Compound Name | [4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methanamine |
|---|---|
| PubChem CID | 107661009 |
| Molecular Formula | C13H12BrCl2NO2 |
| Molecular Weight | 365.05 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | [4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]methanamine |
| SMILES | Cc1oc(CN)cc1COc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C13H12BrCl2NO2/c1-7-8(2-9(5-17)19-7)6-18-13-4-11(15)10(14)3-12(13)16/h2-4H,5-6,17H2,1H3 |
| InChIKey | SSJZHHIRLQDXNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.05 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|