4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid

C15H11BrCl2O3 — CID 107661535

IUPAC4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1COc1cc(Cl)c(Br)cc1Cl
InChIInChI=1S/C15H11BrCl2O3/c1-8-4-9(15(19)20)2-3-10(8)7-21-14-6-12(17)11(16)5-13(14)18/h2-6H,7H2,1H3,(H,19,20)
InChIKeyOZISQWDLQRXPND-UHFFFAOYSA-N
MW390.06 g/mol
LogP5.34
Rot. Bonds4

About 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid

4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid (PubChem CID 107661535) has the molecular formula C15H11BrCl2O3 and a molecular weight of 390.06 g/mol. Its IUPAC name is 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid.

Molecular Properties

Compound Name4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid
PubChem CID107661535
Molecular FormulaC15H11BrCl2O3
Molecular Weight390.06 g/mol
Exact Mass387.93
IUPAC Name4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1COc1cc(Cl)c(Br)cc1Cl
InChIInChI=1S/C15H11BrCl2O3/c1-8-4-9(15(19)20)2-3-10(8)7-21-14-6-12(17)11(16)5-13(14)18/h2-6H,7H2,1H3,(H,19,20)
InChIKeyOZISQWDLQRXPND-UHFFFAOYSA-N
XLogP5.34
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500390.06
LogP ≤ 55.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid?
The IUPAC name of 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid (CID 107661535) is 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid.
What is the SMILES notation for 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid?
The canonical SMILES for 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid is Cc1cc(C(=O)O)ccc1COc1cc(Cl)c(Br)cc1Cl.
What is the InChIKey of 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid?
The InChIKey is OZISQWDLQRXPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrCl2O3/c1-8-4-9(15(19)20)2-3-10(8)7-21-14-6-12(17)11(16)5-13(14)18/h2-6H,7H2,1H3,(H,19,20).
What are the key properties of 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid?
4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid has a molecular weight of 390.06 g/mol, XLogP of 5.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid is sourced from PubChem (CID 107661535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).