C15H11BrCl2O3 — CID 107661535
4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid (PubChem CID 107661535) has the molecular formula C15H11BrCl2O3 and a molecular weight of 390.06 g/mol. Its IUPAC name is 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid.
| Compound Name | 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 107661535 |
| Molecular Formula | C15H11BrCl2O3 |
| Molecular Weight | 390.06 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1COc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C15H11BrCl2O3/c1-8-4-9(15(19)20)2-3-10(8)7-21-14-6-12(17)11(16)5-13(14)18/h2-6H,7H2,1H3,(H,19,20) |
| InChIKey | OZISQWDLQRXPND-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.06 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|