C14H10BrCl3N2O — CID 107658546
4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-chlorobenzenecarboximidamide (PubChem CID 107658546) has the molecular formula C14H10BrCl3N2O and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-chlorobenzenecarboximidamide.
| Compound Name | 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-chlorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107658546 |
| Molecular Formula | C14H10BrCl3N2O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 405.90 |
| IUPAC Name | 4-[(4-bromo-2,5-dichlorophenoxy)methyl]-3-chlorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(COc2cc(Cl)c(Br)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10BrCl3N2O/c15-9-4-12(18)13(5-11(9)17)21-6-8-2-1-7(14(19)20)3-10(8)16/h1-5H,6H2,(H3,19,20) |
| InChIKey | LTYIUNIQLYIVBI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|