C13H8BrCl3N2O — CID 82799225
3-bromo-4-(2,4,5-trichlorophenoxy)benzenecarboximidamide (PubChem CID 82799225) has the molecular formula C13H8BrCl3N2O and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-bromo-4-(2,4,5-trichlorophenoxy)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(2,4,5-trichlorophenoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 82799225 |
| Molecular Formula | C13H8BrCl3N2O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | 3-bromo-4-(2,4,5-trichlorophenoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2cc(Cl)c(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C13H8BrCl3N2O/c14-7-3-6(13(18)19)1-2-11(7)20-12-5-9(16)8(15)4-10(12)17/h1-5H,(H3,18,19) |
| InChIKey | ZRBDCBDQUNUMNF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|