C15H14BrClN2O — CID 82800181
3-bromo-4-(4-chloro-2,6-dimethylphenoxy)benzenecarboximidamide (PubChem CID 82800181) has the molecular formula C15H14BrClN2O and a molecular weight of 353.65 g/mol. Its IUPAC name is 3-bromo-4-(4-chloro-2,6-dimethylphenoxy)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(4-chloro-2,6-dimethylphenoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 82800181 |
| Molecular Formula | C15H14BrClN2O |
| Molecular Weight | 353.65 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 3-bromo-4-(4-chloro-2,6-dimethylphenoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2c(C)cc(Cl)cc2C)c(Br)c1 |
| InChI | InChI=1S/C15H14BrClN2O/c1-8-5-11(17)6-9(2)14(8)20-13-4-3-10(15(18)19)7-12(13)16/h3-7H,1-2H3,(H3,18,19) |
| InChIKey | VTSZNAAWRKFKHW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|