C15H16ClN3O — CID 114769235
2-(4-chloro-2,6-dimethylphenoxy)-6-methylpyridine-4-carboximidamide (PubChem CID 114769235) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylphenoxy)-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-(4-chloro-2,6-dimethylphenoxy)-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114769235 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylphenoxy)-6-methylpyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(Oc2c(C)cc(Cl)cc2C)c1 |
| InChI | InChI=1S/C15H16ClN3O/c1-8-4-12(16)5-9(2)14(8)20-13-7-11(15(17)18)6-10(3)19-13/h4-7H,1-3H3,(H3,17,18) |
| InChIKey | MMECDZSVEDWMRR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|