C13H22N4O — CID 114769367
2-[2-(dimethylamino)-2-methylpropoxy]-6-methylpyridine-4-carboximidamide (PubChem CID 114769367) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-methylpropoxy]-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-[2-(dimethylamino)-2-methylpropoxy]-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114769367 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-[2-(dimethylamino)-2-methylpropoxy]-6-methylpyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(OCC(C)(C)N(C)C)c1 |
| InChI | InChI=1S/C13H22N4O/c1-9-6-10(12(14)15)7-11(16-9)18-8-13(2,3)17(4)5/h6-7H,8H2,1-5H3,(H3,14,15) |
| InChIKey | RUNWJWONHOHQOA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|