C9H14N4 — CID 114769014
2-(ethylamino)-6-methylpyridine-4-carboximidamide (PubChem CID 114769014) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-(ethylamino)-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-(ethylamino)-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114769014 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-(ethylamino)-6-methylpyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(NCC)c1 |
| InChI | InChI=1S/C9H14N4/c1-3-12-8-5-7(9(10)11)4-6(2)13-8/h4-5H,3H2,1-2H3,(H3,10,11)(H,12,13) |
| InChIKey | YYTCMZWOVZULIG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|