C10H10BrN5O — CID 106597271
3-bromo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide (PubChem CID 106597271) has the molecular formula C10H10BrN5O and a molecular weight of 296.13 g/mol. Its IUPAC name is 3-bromo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide.
| Compound Name | 3-bromo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 106597271 |
| Molecular Formula | C10H10BrN5O |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 3-bromo-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2ncn(C)n2)c(Br)c1 |
| InChI | InChI=1S/C10H10BrN5O/c1-16-5-14-10(15-16)17-8-3-2-6(9(12)13)4-7(8)11/h2-5H,1H3,(H3,12,13) |
| InChIKey | DURSQZVADAKKRU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|