C14H8BrCl2FO3 — CID 107654987
3-[(4-bromo-2,5-dichlorophenoxy)methyl]-4-fluorobenzoic acid (PubChem CID 107654987) has the molecular formula C14H8BrCl2FO3 and a molecular weight of 394.02 g/mol. Its IUPAC name is 3-[(4-bromo-2,5-dichlorophenoxy)methyl]-4-fluorobenzoic acid.
| Compound Name | 3-[(4-bromo-2,5-dichlorophenoxy)methyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 107654987 |
| Molecular Formula | C14H8BrCl2FO3 |
| Molecular Weight | 394.02 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 3-[(4-bromo-2,5-dichlorophenoxy)methyl]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(COc2cc(Cl)c(Br)cc2Cl)c1 |
| InChI | InChI=1S/C14H8BrCl2FO3/c15-9-4-11(17)13(5-10(9)16)21-6-8-3-7(14(19)20)1-2-12(8)18/h1-5H,6H2,(H,19,20) |
| InChIKey | IXZOGPGMJQZXOL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.02 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|