C14H21NO3 — CID 62444616
N-[[2-(oxolan-2-ylmethoxymethyl)furan-3-yl]methyl]cyclopropanamine (PubChem CID 62444616) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[[2-(oxolan-2-ylmethoxymethyl)furan-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(oxolan-2-ylmethoxymethyl)furan-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62444616 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[[2-(oxolan-2-ylmethoxymethyl)furan-3-yl]methyl]cyclopropanamine |
| SMILES | c1cc(CNC2CC2)c(COCC2CCCO2)o1 |
| InChI | InChI=1S/C14H21NO3/c1-2-13(17-6-1)9-16-10-14-11(5-7-18-14)8-15-12-3-4-12/h5,7,12-13,15H,1-4,6,8-10H2 |
| InChIKey | ZILWIFUYDCRQFB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |