C16H20N2O2 — CID 62455562
N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]cyclopropanamine (PubChem CID 62455562) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62455562 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]cyclopropanamine |
| SMILES | c1ccc(CCOCc2occc2CNC2CC2)nc1 |
| InChI | InChI=1S/C16H20N2O2/c1-2-8-17-14(3-1)7-9-19-12-16-13(6-10-20-16)11-18-15-4-5-15/h1-3,6,8,10,15,18H,4-5,7,9,11-12H2 |
| InChIKey | XHWSXBMVPRLVGQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|