C16H22N2O2 — CID 62455387
N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]propan-1-amine (PubChem CID 62455387) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62455387 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[[2-(2-pyridin-2-ylethoxymethyl)furan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccoc1COCCc1ccccn1 |
| InChI | InChI=1S/C16H22N2O2/c1-2-8-17-12-14-6-11-20-16(14)13-19-10-7-15-5-3-4-9-18-15/h3-6,9,11,17H,2,7-8,10,12-13H2,1H3 |
| InChIKey | JBBJDFWRYMIVTJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|