C12H17IN2O2 — CID 97215805
3-iodo-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyridin-2-amine (PubChem CID 97215805) has the molecular formula C12H17IN2O2 and a molecular weight of 348.18 g/mol. Its IUPAC name is 3-iodo-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyridin-2-amine.
| Compound Name | 3-iodo-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 97215805 |
| Molecular Formula | C12H17IN2O2 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-iodo-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]pyridin-2-amine |
| SMILES | Ic1cccnc1NCCOC[C@H]1CCCO1 |
| InChI | InChI=1S/C12H17IN2O2/c13-11-4-1-5-14-12(11)15-6-8-16-9-10-3-2-7-17-10/h1,4-5,10H,2-3,6-9H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | JYFKGFCRWWDLFW-SNVBAGLBSA-N |
| XLogP | 2.29 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|