C12H14F4N2O2 — CID 133388031
2,3,5,6-tetrafluoro-N-[2-(oxolan-2-ylmethoxy)ethyl]pyridin-4-amine (PubChem CID 133388031) has the molecular formula C12H14F4N2O2 and a molecular weight of 294.25 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[2-(oxolan-2-ylmethoxy)ethyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[2-(oxolan-2-ylmethoxy)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133388031 |
| Molecular Formula | C12H14F4N2O2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[2-(oxolan-2-ylmethoxy)ethyl]pyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NCCOCC2CCCO2)c1F |
| InChI | InChI=1S/C12H14F4N2O2/c13-8-10(9(14)12(16)18-11(8)15)17-3-5-19-6-7-2-1-4-20-7/h7H,1-6H2,(H,17,18) |
| InChIKey | GJVSSCYTWARLGP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|