C12H16N4O4S — CID 133314983
5-nitro-N-[2-(oxolan-2-ylmethoxy)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 133314983) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 5-nitro-N-[2-(oxolan-2-ylmethoxy)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-nitro-N-[2-(oxolan-2-ylmethoxy)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 133314983 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-nitro-N-[2-(oxolan-2-ylmethoxy)ethyl]imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCCOCC2CCCO2)nc2sccn12 |
| InChI | InChI=1S/C12H16N4O4S/c17-16(18)11-10(14-12-15(11)4-7-21-12)13-3-6-19-8-9-2-1-5-20-9/h4,7,9,13H,1-3,5-6,8H2 |
| InChIKey | XPJCPRQXJXMXGW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|