About N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine
N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 47292439) has the molecular formula C9H12N4O4S2
and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
Molecular Properties
| Compound Name | N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| PubChem CID | 47292439 |
| Molecular Formula | C9H12N4O4S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CS(=O)(=O)CCCNc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O4S2/c1-19(16,17)6-2-3-10-7-8(13(14)15)12-4-5-18-9(12)11-7/h4-5,10H,2-3,6H2,1H3 |
| InChIKey | QZZYBJYWJCADHM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
The IUPAC name of N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (CID 47292439) is N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
What is the SMILES notation for N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
The canonical SMILES for N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine is CS(=O)(=O)CCCNc1nc2sccn2c1[N+](=O)[O-].
What is the InChIKey of N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
The InChIKey is QZZYBJYWJCADHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O4S2/c1-19(16,17)6-2-3-10-7-8(13(14)15)12-4-5-18-9(12)11-7/h4-5,10H,2-3,6H2,1H3.
What are the key properties of N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine has a molecular weight of 304.35 g/mol, XLogP of 1.15, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylsulfonylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine is sourced from PubChem (CID 47292439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).