C12H18N6O2S — CID 60701927
N-[2-(4-methylpiperazin-1-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 60701927) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 60701927 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CN1CCN(CCNc2nc3sccn3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H18N6O2S/c1-15-4-6-16(7-5-15)3-2-13-10-11(18(19)20)17-8-9-21-12(17)14-10/h8-9,13H,2-7H2,1H3 |
| InChIKey | GVDFERNERYWSNJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|