C9H12N4O2S2 — CID 63965950
N-(3-methylsulfanylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 63965950) has the molecular formula C9H12N4O2S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-(3-methylsulfanylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 63965950 |
| Molecular Formula | C9H12N4O2S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CSCCCNc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O2S2/c1-16-5-2-3-10-7-8(13(14)15)12-4-6-17-9(12)11-7/h4,6,10H,2-3,5H2,1H3 |
| InChIKey | SEKOBIHTXDRPPX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|