C11H16N6O2S — CID 43600445
5-nitro-N-(2-piperazin-1-ylethyl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 43600445) has the molecular formula C11H16N6O2S and a molecular weight of 296.36 g/mol. Its IUPAC name is 5-nitro-N-(2-piperazin-1-ylethyl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-nitro-N-(2-piperazin-1-ylethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 43600445 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-nitro-N-(2-piperazin-1-ylethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCNCC2)nc2sccn12 |
| InChI | InChI=1S/C11H16N6O2S/c18-17(19)10-9(14-11-16(10)7-8-20-11)13-3-6-15-4-1-12-2-5-15/h7-8,12-13H,1-6H2 |
| InChIKey | QHMVEPDHWWKANU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|