C16H20N8O2S — CID 25330104
5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 25330104) has the molecular formula C16H20N8O2S and a molecular weight of 388.46 g/mol. Its IUPAC name is 5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 25330104 |
| Molecular Formula | C16H20N8O2S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCCCN2CCN(c3ncccn3)CC2)nc2sccn12 |
| InChI | InChI=1S/C16H20N8O2S/c25-24(26)14-13(20-16-23(14)11-12-27-16)17-5-2-6-21-7-9-22(10-8-21)15-18-3-1-4-19-15/h1,3-4,11-12,17H,2,5-10H2 |
| InChIKey | DSZUXAINRKELIK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|