C12H10N6O3S — CID 133367582
2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]-N-pyridin-2-ylacetamide (PubChem CID 133367582) has the molecular formula C12H10N6O3S and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 133367582 |
| Molecular Formula | C12H10N6O3S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]-N-pyridin-2-ylacetamide |
| SMILES | O=C(CNc1nc2sccn2c1[N+](=O)[O-])Nc1ccccn1 |
| InChI | InChI=1S/C12H10N6O3S/c19-9(15-8-3-1-2-4-13-8)7-14-10-11(18(20)21)17-5-6-22-12(17)16-10/h1-6,14H,7H2,(H,13,15,19) |
| InChIKey | HTIAFDYYXBTVFW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|