C19H19N5O2S — CID 18205633
N-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 18205633) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 18205633 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | Cc1cc(CCNc2nc3sccn3c2[N+](=O)[O-])c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C19H19N5O2S/c1-13-12-15(14(2)23(13)16-6-4-3-5-7-16)8-9-20-17-18(24(25)26)22-10-11-27-19(22)21-17/h3-7,10-12,20H,8-9H2,1-2H3 |
| InChIKey | FCUGRBMEOZXZLS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|