C15H12FN5O2S — CID 133278312
N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 133278312) has the molecular formula C15H12FN5O2S and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 133278312 |
| Molecular Formula | C15H12FN5O2S |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCCc2c[nH]c3cc(F)ccc23)nc2sccn12 |
| InChI | InChI=1S/C15H12FN5O2S/c16-10-1-2-11-9(8-18-12(11)7-10)3-4-17-13-14(21(22)23)20-5-6-24-15(20)19-13/h1-2,5-8,17-18H,3-4H2 |
| InChIKey | YKOKWGCYJACOGM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|