C17H17FN4O3S — CID 60570114
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 60570114) has the molecular formula C17H17FN4O3S and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 60570114 |
| Molecular Formula | C17H17FN4O3S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCC2(c3ccc(F)cc3)CCOCC2)nc2sccn12 |
| InChI | InChI=1S/C17H17FN4O3S/c18-13-3-1-12(2-4-13)17(5-8-25-9-6-17)11-19-14-15(22(23)24)21-7-10-26-16(21)20-14/h1-4,7,10,19H,5-6,8-9,11H2 |
| InChIKey | XMBGFRNRZNHXBH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|