C10H9N5O3S — CID 48736144
N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 48736144) has the molecular formula C10H9N5O3S and a molecular weight of 279.28 g/mol. Its IUPAC name is N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 48736144 |
| Molecular Formula | C10H9N5O3S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | Cc1cc(CNc2nc3sccn3c2[N+](=O)[O-])on1 |
| InChI | InChI=1S/C10H9N5O3S/c1-6-4-7(18-13-6)5-11-8-9(15(16)17)14-2-3-19-10(14)12-8/h2-4,11H,5H2,1H3 |
| InChIKey | HQEPDLMUMWFIDA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|