C9H11N5O3S — CID 43388438
N,N-dimethyl-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetamide (PubChem CID 43388438) has the molecular formula C9H11N5O3S and a molecular weight of 269.29 g/mol. Its IUPAC name is N,N-dimethyl-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetamide.
| Compound Name | N,N-dimethyl-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 43388438 |
| Molecular Formula | C9H11N5O3S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N,N-dimethyl-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetamide |
| SMILES | CN(C)C(=O)CNc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N5O3S/c1-12(2)6(15)5-10-7-8(14(16)17)13-3-4-18-9(13)11-7/h3-4,10H,5H2,1-2H3 |
| InChIKey | PROKQSUJVJFPCX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|