C10H12N4O2S — CID 43427706
N-(cyclobutylmethyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 43427706) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-(cyclobutylmethyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 43427706 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(cyclobutylmethyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCC2CCC2)nc2sccn12 |
| InChI | InChI=1S/C10H12N4O2S/c15-14(16)9-8(11-6-7-2-1-3-7)12-10-13(9)4-5-17-10/h4-5,7,11H,1-3,6H2 |
| InChIKey | MBALUKFDAHISHI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|